C19H15NO3S — CID 22681836
2-[4-(2-prop-2-enylphenoxy)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 22681836) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[4-(2-prop-2-enylphenoxy)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-(2-prop-2-enylphenoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 22681836 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[4-(2-prop-2-enylphenoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C=CCc1ccccc1Oc1ccc(-c2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C19H15NO3S/c1-2-5-13-6-3-4-7-17(13)23-15-10-8-14(9-11-15)18-20-16(12-24-18)19(21)22/h2-4,6-12H,1,5H2,(H,21,22) |
| InChIKey | WWGHEDHFQFZNRD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|