C17H18N2O2S — CID 39160338
2-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 39160338) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 39160338 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[4-[[bis(prop-2-enyl)amino]methyl]phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C=CCN(CC=C)Cc1ccc(-c2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-3-9-19(10-4-2)11-13-5-7-14(8-6-13)16-18-15(12-22-16)17(20)21/h3-8,12H,1-2,9-11H2,(H,20,21) |
| InChIKey | UAWMYPILARZNFO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|