C15H15NO2S2 — CID 82178460
2-[4-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 82178460) has the molecular formula C15H15NO2S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[4-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[4-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82178460 |
| Molecular Formula | C15H15NO2S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-[4-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C=C(C)CSCc1ccc(-c2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C15H15NO2S2/c1-10(2)7-19-8-11-3-5-12(6-4-11)14-16-13(9-20-14)15(17)18/h3-6,9H,1,7-8H2,2H3,(H,17,18) |
| InChIKey | JSCIGCPBQXWIPA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|