C16H17NO2S2 — CID 94805173
2-[2-[3-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 94805173) has the molecular formula C16H17NO2S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[2-[3-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[3-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 94805173 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[2-[3-(2-methylprop-2-enylsulfanylmethyl)phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | C=C(C)CSCc1cccc(-c2nc(CC(=O)O)cs2)c1 |
| InChI | InChI=1S/C16H17NO2S2/c1-11(2)8-20-9-12-4-3-5-13(6-12)16-17-14(10-21-16)7-15(18)19/h3-6,10H,1,7-9H2,2H3,(H,18,19) |
| InChIKey | ZBEWJZWIXMLDJY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|