C13H19ClNO+ — CID 7413567
2-(4-chloro-2-prop-2-enylphenoxy)ethyl-dimethylazanium (PubChem CID 7413567) has the molecular formula C13H19ClNO+ and a molecular weight of 240.75 g/mol. Its IUPAC name is 2-(4-chloro-2-prop-2-enylphenoxy)ethyl-dimethylazanium.
| Compound Name | 2-(4-chloro-2-prop-2-enylphenoxy)ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7413567 |
| Molecular Formula | C13H19ClNO+ |
| Molecular Weight | 240.75 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(4-chloro-2-prop-2-enylphenoxy)ethyl-dimethylazanium |
| SMILES | C=CCc1cc(Cl)ccc1OCC[NH+](C)C |
| InChI | InChI=1S/C13H18ClNO/c1-4-5-11-10-12(14)6-7-13(11)16-9-8-15(2)3/h4,6-7,10H,1,5,8-9H2,2-3H3/p+1 |
| InChIKey | ATSQKJJGZQDNKO-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|