C38H43N3O9 — CID 135977716
6-[4-[2-hydroxy-4-(2-methoxyethoxy)-3-prop-2-enylphenyl]-6-[2-hydroxy-4-(methoxymethoxy)-3-prop-2-enylphenyl]-1,3,5-triazin-2-yl]-3-(2-methoxyethoxy)-2-prop-2-enylphenol (PubChem CID 135977716) has the molecular formula C38H43N3O9 and a molecular weight of 685.77 g/mol. Its IUPAC name is 6-[4-[2-hydroxy-4-(2-methoxyethoxy)-3-prop-2-enylphenyl]-6-[2-hydroxy-4-(methoxymethoxy)-3-prop-2-enylphenyl]-1,3,5-triazin-2-yl]-3-(2-methoxyethoxy)-2-prop-2-enylphenol.
| Compound Name | 6-[4-[2-hydroxy-4-(2-methoxyethoxy)-3-prop-2-enylphenyl]-6-[2-hydroxy-4-(methoxymethoxy)-3-prop-2-enylphenyl]-1,3,5-triazin-2-yl]-3-(2-methoxyethoxy)-2-prop-2-enylphenol |
|---|---|
| PubChem CID | 135977716 |
| Molecular Formula | C38H43N3O9 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | 6-[4-[2-hydroxy-4-(2-methoxyethoxy)-3-prop-2-enylphenyl]-6-[2-hydroxy-4-(methoxymethoxy)-3-prop-2-enylphenyl]-1,3,5-triazin-2-yl]-3-(2-methoxyethoxy)-2-prop-2-enylphenol |
| SMILES | C=CCc1c(OCCOC)ccc(-c2nc(-c3ccc(OCCOC)c(CC=C)c3O)nc(-c3ccc(OCOC)c(CC=C)c3O)n2)c1O |
| InChI | InChI=1S/C38H43N3O9/c1-7-10-24-30(48-21-19-45-4)16-13-27(33(24)42)36-39-37(28-14-17-31(49-22-20-46-5)25(11-8-2)34(28)43)41-38(40-36)29-15-18-32(50-23-47-6)26(12-9-3)35(29)44/h7-9,13-18,42-44H,1-3,10-12,19-23H2,4-6H3 |
| InChIKey | DTGIZBJRMBKKAY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|