C33H42O8 — CID 163821993
methane;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-ol;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-one (PubChem CID 163821993) has the molecular formula C33H42O8 and a molecular weight of 566.69 g/mol. Its IUPAC name is methane;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-ol;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-one.
| Compound Name | methane;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-ol;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-one |
|---|---|
| PubChem CID | 163821993 |
| Molecular Formula | C33H42O8 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | methane;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-ol;4-(methoxymethoxy)-1-(3-methoxy-2-prop-2-enylphenyl)but-2-yn-1-one |
| SMILES | C.C=CCc1c(OC)cccc1C(=O)C#CCOCOC.C=CCc1c(OC)cccc1C(O)C#CCOCOC |
| InChI | InChI=1S/C16H20O4.C16H18O4.CH4/c2*1-4-7-14-13(8-5-10-16(14)19-3)15(17)9-6-11-20-12-18-2;/h4-5,8,10,15,17H,1,7,11-12H2,2-3H3;4-5,8,10H,1,7,11-12H2,2-3H3;1H4 |
| InChIKey | NWEOVSHNWQVVFV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|