C17H22O3 — CID 137451301
(6S)-1-(3-methoxy-2-prop-2-enylphenyl)hept-2-yne-1,6-diol (PubChem CID 137451301) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (6S)-1-(3-methoxy-2-prop-2-enylphenyl)hept-2-yne-1,6-diol.
| Compound Name | (6S)-1-(3-methoxy-2-prop-2-enylphenyl)hept-2-yne-1,6-diol |
|---|---|
| PubChem CID | 137451301 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (6S)-1-(3-methoxy-2-prop-2-enylphenyl)hept-2-yne-1,6-diol |
| SMILES | C=CCc1c(OC)cccc1C(O)C#CCC[C@H](C)O |
| InChI | InChI=1S/C17H22O3/c1-4-8-15-14(10-7-12-17(15)20-3)16(19)11-6-5-9-13(2)18/h4,7,10,12-13,16,18-19H,1,5,8-9H2,2-3H3/t13-,16?/m0/s1 |
| InChIKey | ZGZDYYVGPGPJQW-KNVGNIICSA-N |
| XLogP | 2.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|