C21H30O2 — CID 142989068
(6S)-1-(3-methoxy-2-prop-2-enylphenyl)undec-2-yn-6-ol (PubChem CID 142989068) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (6S)-1-(3-methoxy-2-prop-2-enylphenyl)undec-2-yn-6-ol.
| Compound Name | (6S)-1-(3-methoxy-2-prop-2-enylphenyl)undec-2-yn-6-ol |
|---|---|
| PubChem CID | 142989068 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (6S)-1-(3-methoxy-2-prop-2-enylphenyl)undec-2-yn-6-ol |
| SMILES | C=CCc1c(CC#CCC[C@@H](O)CCCCC)cccc1OC |
| InChI | InChI=1S/C21H30O2/c1-4-6-8-15-19(22)16-10-7-9-13-18-14-11-17-21(23-3)20(18)12-5-2/h5,11,14,17,19,22H,2,4,6,8,10,12-13,15-16H2,1,3H3/t19-/m0/s1 |
| InChIKey | HYXZRBSZPZMLDB-IBGZPJMESA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|