C24H36O — CID 157251866
2-(7-methoxydodec-3-yn-2-yl)-1,4-dimethyl-3-prop-2-enylbenzene (PubChem CID 157251866) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is 2-(7-methoxydodec-3-yn-2-yl)-1,4-dimethyl-3-prop-2-enylbenzene.
| Compound Name | 2-(7-methoxydodec-3-yn-2-yl)-1,4-dimethyl-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 157251866 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 2-(7-methoxydodec-3-yn-2-yl)-1,4-dimethyl-3-prop-2-enylbenzene |
| SMILES | C=CCc1c(C)ccc(C)c1C(C)C#CCCC(CCCCC)OC |
| InChI | InChI=1S/C24H36O/c1-7-9-10-15-22(25-6)16-12-11-14-20(4)24-21(5)18-17-19(3)23(24)13-8-2/h8,17-18,20,22H,2,7,9-10,12-13,15-16H2,1,3-6H3 |
| InChIKey | GJUIMMZFIXWBHU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|