C11H13I — CID 129267605
2-iodo-1,4-dimethyl-3-prop-2-enylbenzene (PubChem CID 129267605) has the molecular formula C11H13I and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-iodo-1,4-dimethyl-3-prop-2-enylbenzene.
| Compound Name | 2-iodo-1,4-dimethyl-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 129267605 |
| Molecular Formula | C11H13I |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 2-iodo-1,4-dimethyl-3-prop-2-enylbenzene |
| SMILES | C=CCc1c(C)ccc(C)c1I |
| InChI | InChI=1S/C11H13I/c1-4-5-10-8(2)6-7-9(3)11(10)12/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | AQZSHPYCHMKERH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|