C22H32O — CID 20743127
6-methyl-1-(3-methyl-2-prop-2-enylphenyl)undec-2-yn-1-ol (PubChem CID 20743127) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is 6-methyl-1-(3-methyl-2-prop-2-enylphenyl)undec-2-yn-1-ol.
| Compound Name | 6-methyl-1-(3-methyl-2-prop-2-enylphenyl)undec-2-yn-1-ol |
|---|---|
| PubChem CID | 20743127 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 6-methyl-1-(3-methyl-2-prop-2-enylphenyl)undec-2-yn-1-ol |
| SMILES | C=CCc1c(C)cccc1C(O)C#CCCC(C)CCCCC |
| InChI | InChI=1S/C22H32O/c1-5-7-8-13-18(3)14-9-10-17-22(23)21-16-11-15-19(4)20(21)12-6-2/h6,11,15-16,18,22-23H,2,5,7-9,12-14H2,1,3-4H3 |
| InChIKey | NLEIAOMBBJYUFN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|