C32H42O4 — CID 11156084
(6S)-6-(oxan-2-yloxy)-1-(3-phenylmethoxy-2-prop-2-enylphenyl)undec-2-yn-1-ol (PubChem CID 11156084) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is (6S)-6-(oxan-2-yloxy)-1-(3-phenylmethoxy-2-prop-2-enylphenyl)undec-2-yn-1-ol.
| Compound Name | (6S)-6-(oxan-2-yloxy)-1-(3-phenylmethoxy-2-prop-2-enylphenyl)undec-2-yn-1-ol |
|---|---|
| PubChem CID | 11156084 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | (6S)-6-(oxan-2-yloxy)-1-(3-phenylmethoxy-2-prop-2-enylphenyl)undec-2-yn-1-ol |
| SMILES | C=CCc1c(OCc2ccccc2)cccc1C(O)C#CCC[C@H](CCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C32H42O4/c1-3-5-7-18-27(36-32-23-12-13-24-34-32)19-10-11-21-30(33)28-20-14-22-31(29(28)15-4-2)35-25-26-16-8-6-9-17-26/h4,6,8-9,14,16-17,20,22,27,30,32-33H,2-3,5,7,10,12-13,15,18-19,23-25H2,1H3/t27-,30?,32?/m0/s1 |
| InChIKey | QZLXRCBYRKIFSS-DNBJBPHPSA-N |
| XLogP | 7.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|