C22H30O3 — CID 121279886
2-[6-(3-methoxy-2-prop-2-enylphenyl)hept-4-ynoxy]oxane (PubChem CID 121279886) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-[6-(3-methoxy-2-prop-2-enylphenyl)hept-4-ynoxy]oxane.
| Compound Name | 2-[6-(3-methoxy-2-prop-2-enylphenyl)hept-4-ynoxy]oxane |
|---|---|
| PubChem CID | 121279886 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-[6-(3-methoxy-2-prop-2-enylphenyl)hept-4-ynoxy]oxane |
| SMILES | C=CCc1c(OC)cccc1C(C)C#CCCCOC1CCCCO1 |
| InChI | InChI=1S/C22H30O3/c1-4-11-20-19(13-10-14-21(20)23-3)18(2)12-6-5-8-16-24-22-15-7-9-17-25-22/h4,10,13-14,18,22H,1,5,7-9,11,15-17H2,2-3H3 |
| InChIKey | LJVQFKBKXCPLCY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|