C32H52O3Si — CID 59906212
tert-butyl-dimethyl-[(1S,6S)-1-(3-methyl-2-prop-2-enylphenyl)-6-(oxan-2-yloxy)undec-2-ynoxy]silane (PubChem CID 59906212) has the molecular formula C32H52O3Si and a molecular weight of 512.85 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,6S)-1-(3-methyl-2-prop-2-enylphenyl)-6-(oxan-2-yloxy)undec-2-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S,6S)-1-(3-methyl-2-prop-2-enylphenyl)-6-(oxan-2-yloxy)undec-2-ynoxy]silane |
|---|---|
| PubChem CID | 59906212 |
| Molecular Formula | C32H52O3Si |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,6S)-1-(3-methyl-2-prop-2-enylphenyl)-6-(oxan-2-yloxy)undec-2-ynoxy]silane |
| SMILES | C=CCc1c(C)cccc1[C@H](C#CCC[C@H](CCCCC)OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H52O3Si/c1-9-11-12-20-27(34-31-24-15-16-25-33-31)21-13-14-23-30(35-36(7,8)32(4,5)6)29-22-17-19-26(3)28(29)18-10-2/h10,17,19,22,27,30-31H,2,9,11-13,15-16,18,20-21,24-25H2,1,3-8H3/t27-,30-,31?/m0/s1 |
| InChIKey | QCBUDLQFCOROEZ-IVGKLQETSA-N |
| XLogP | 9.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|