C35H42O4 — CID 56640235
(1S,6S)-1-[3-[(4-methoxyphenyl)methoxy]-2-prop-2-enylphenyl]-6-phenylmethoxyundec-2-yn-1-ol (PubChem CID 56640235) has the molecular formula C35H42O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is (1S,6S)-1-[3-[(4-methoxyphenyl)methoxy]-2-prop-2-enylphenyl]-6-phenylmethoxyundec-2-yn-1-ol.
| Compound Name | (1S,6S)-1-[3-[(4-methoxyphenyl)methoxy]-2-prop-2-enylphenyl]-6-phenylmethoxyundec-2-yn-1-ol |
|---|---|
| PubChem CID | 56640235 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (1S,6S)-1-[3-[(4-methoxyphenyl)methoxy]-2-prop-2-enylphenyl]-6-phenylmethoxyundec-2-yn-1-ol |
| SMILES | C=CCc1c(OCc2ccc(OC)cc2)cccc1[C@@H](O)C#CCC[C@H](CCCCC)OCc1ccccc1 |
| InChI | InChI=1S/C35H42O4/c1-4-6-8-17-31(38-26-28-15-9-7-10-16-28)18-11-12-20-34(36)32-19-13-21-35(33(32)14-5-2)39-27-29-22-24-30(37-3)25-23-29/h5,7,9-10,13,15-16,19,21-25,31,34,36H,2,4,6,8,11,14,17-18,26-27H2,1,3H3/t31-,34-/m0/s1 |
| InChIKey | DNSYIZWNMOUMBI-VBTAUBHQSA-N |
| XLogP | 7.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|