About (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium
(6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium (PubChem CID 147024301) has the molecular formula C23H33O2Y-
and a molecular weight of 430.42 g/mol. Its IUPAC name is (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium.
Molecular Properties
| Compound Name | (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium |
| PubChem CID | 147024301 |
| Molecular Formula | C23H33O2Y- |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium |
| SMILES | C=CCc1c(C)[c-]cc(C)c1C(O)C#CCC[C@H](CCCCC)OC.[Y] |
| InChI | InChI=1S/C23H33O2.Y/c1-6-8-9-13-20(25-5)14-10-11-15-22(24)23-19(4)17-16-18(3)21(23)12-7-2;/h7,17,20,22,24H,2,6,8-10,12-14H2,1,3-5H3;/q-1;/t20-,22?;/m0./s1 |
| InChIKey | LTBJAOMSGVNTFF-CNAJMHLNSA-N |
| XLogP | 5.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium?
The IUPAC name of (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium (CID 147024301) is (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium.
What is the SMILES notation for (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium?
The canonical SMILES for (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium is C=CCc1c(C)[c-]cc(C)c1C(O)C#CCC[C@H](CCCCC)OC.[Y].
What is the InChIKey of (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium?
The InChIKey is LTBJAOMSGVNTFF-CNAJMHLNSA-N. The full InChI is InChI=1S/C23H33O2.Y/c1-6-8-9-13-20(25-5)14-10-11-15-22(24)23-19(4)17-16-18(3)21(23)12-7-2;/h7,17,20,22,24H,2,6,8-10,12-14H2,1,3-5H3;/q-1;/t20-,22?;/m0./s1.
What are the key properties of (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium?
(6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium has a molecular weight of 430.42 g/mol, XLogP of 5.24, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-(3,6-dimethyl-2-prop-2-enylbenzene-4-id-1-yl)-6-methoxyundec-2-yn-1-ol;yttrium is sourced from PubChem (CID 147024301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).