C22H19NO7 — CID 54479874
ethyl 7-[3-(4-cyanophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate (PubChem CID 54479874) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is ethyl 7-[3-(4-cyanophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 7-[3-(4-cyanophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 54479874 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | ethyl 7-[3-(4-cyanophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2ccc(OCC(O)COc3ccc(C#N)cc3)cc2o1 |
| InChI | InChI=1S/C22H19NO7/c1-2-27-22(26)21-10-19(25)18-8-7-17(9-20(18)30-21)29-13-15(24)12-28-16-5-3-14(11-23)4-6-16/h3-10,15,24H,2,12-13H2,1H3 |
| InChIKey | XOGFDTHVHYLMIG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |