C21H19NO4 — CID 109413972
4-[1-hydroxy-2-(2-oxo-4-propylchromen-7-yl)oxyethyl]benzonitrile (PubChem CID 109413972) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(2-oxo-4-propylchromen-7-yl)oxyethyl]benzonitrile.
| Compound Name | 4-[1-hydroxy-2-(2-oxo-4-propylchromen-7-yl)oxyethyl]benzonitrile |
|---|---|
| PubChem CID | 109413972 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-[1-hydroxy-2-(2-oxo-4-propylchromen-7-yl)oxyethyl]benzonitrile |
| SMILES | CCCc1cc(=O)oc2cc(OCC(O)c3ccc(C#N)cc3)ccc12 |
| InChI | InChI=1S/C21H19NO4/c1-2-3-16-10-21(24)26-20-11-17(8-9-18(16)20)25-13-19(23)15-6-4-14(12-22)5-7-15/h4-11,19,23H,2-3,13H2,1H3 |
| InChIKey | MRHYYQDUEOIIFI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|