C18H14F2O4 — CID 109413301
7-[2-(3,4-difluorophenyl)-2-hydroxyethoxy]-4-methylchromen-2-one (PubChem CID 109413301) has the molecular formula C18H14F2O4 and a molecular weight of 332.30 g/mol. Its IUPAC name is 7-[2-(3,4-difluorophenyl)-2-hydroxyethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-(3,4-difluorophenyl)-2-hydroxyethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 109413301 |
| Molecular Formula | C18H14F2O4 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 7-[2-(3,4-difluorophenyl)-2-hydroxyethoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(O)c3ccc(F)c(F)c3)ccc12 |
| InChI | InChI=1S/C18H14F2O4/c1-10-6-18(22)24-17-8-12(3-4-13(10)17)23-9-16(21)11-2-5-14(19)15(20)7-11/h2-8,16,21H,9H2,1H3 |
| InChIKey | QBCJGNPQYKOEPA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|