C22H24O6 — CID 1325534
4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one (PubChem CID 1325534) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one.
| Compound Name | 4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 1325534 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-propyl-7-[(3,4,5-trimethoxyphenyl)methoxy]chromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3cc(OC)c(OC)c(OC)c3)ccc12 |
| InChI | InChI=1S/C22H24O6/c1-5-6-15-11-21(23)28-18-12-16(7-8-17(15)18)27-13-14-9-19(24-2)22(26-4)20(10-14)25-3/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | SARPVAGKTSRDNX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|