C24H24O5 — CID 54194018
ethyl 3-(4-oxo-7-phenylmethoxy-8-propylchromen-2-yl)prop-2-enoate (PubChem CID 54194018) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl 3-(4-oxo-7-phenylmethoxy-8-propylchromen-2-yl)prop-2-enoate.
| Compound Name | ethyl 3-(4-oxo-7-phenylmethoxy-8-propylchromen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 54194018 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethyl 3-(4-oxo-7-phenylmethoxy-8-propylchromen-2-yl)prop-2-enoate |
| SMILES | CCCc1c(OCc2ccccc2)ccc2c(=O)cc(C=CC(=O)OCC)oc12 |
| InChI | InChI=1S/C24H24O5/c1-3-8-20-22(28-16-17-9-6-5-7-10-17)13-12-19-21(25)15-18(29-24(19)20)11-14-23(26)27-4-2/h5-7,9-15H,3-4,8,16H2,1-2H3 |
| InChIKey | PKMSPEUMWVMHOG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|