C17H26O3 — CID 57258808
1-(4-hexan-3-yloxy-2-hydroxy-3-propylphenyl)ethanone (PubChem CID 57258808) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-(4-hexan-3-yloxy-2-hydroxy-3-propylphenyl)ethanone.
| Compound Name | 1-(4-hexan-3-yloxy-2-hydroxy-3-propylphenyl)ethanone |
|---|---|
| PubChem CID | 57258808 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(4-hexan-3-yloxy-2-hydroxy-3-propylphenyl)ethanone |
| SMILES | CCCc1c(OC(CC)CCC)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C17H26O3/c1-5-8-13(7-3)20-16-11-10-14(12(4)18)17(19)15(16)9-6-2/h10-11,13,19H,5-9H2,1-4H3 |
| InChIKey | ZVDSBZYVBSVVMW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |