C14H19NO4S2 — CID 23336679
(4-acetyl-3-hydroxy-2-propylphenyl) N,N-bis(methylsulfanyl)carbamate (PubChem CID 23336679) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (4-acetyl-3-hydroxy-2-propylphenyl) N,N-bis(methylsulfanyl)carbamate.
| Compound Name | (4-acetyl-3-hydroxy-2-propylphenyl) N,N-bis(methylsulfanyl)carbamate |
|---|---|
| PubChem CID | 23336679 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (4-acetyl-3-hydroxy-2-propylphenyl) N,N-bis(methylsulfanyl)carbamate |
| SMILES | CCCc1c(OC(=O)N(SC)SC)ccc(C(C)=O)c1O |
| InChI | InChI=1S/C14H19NO4S2/c1-5-6-11-12(19-14(18)15(20-3)21-4)8-7-10(9(2)16)13(11)17/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | RMMKUWDGRFZOLY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|