C26H38N4O4 — CID 142867043
4-[4-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-propylphenoxy]butoxy]-N'-hydrazinylbenzenecarboximidamide (PubChem CID 142867043) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-[4-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-propylphenoxy]butoxy]-N'-hydrazinylbenzenecarboximidamide.
| Compound Name | 4-[4-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-propylphenoxy]butoxy]-N'-hydrazinylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142867043 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 4-[4-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-propylphenoxy]butoxy]-N'-hydrazinylbenzenecarboximidamide |
| SMILES | CCCc1c(OCCCCOc2ccc(/C(N)=N/NN)cc2)ccc(C(=O)CC(C)(C)C)c1O |
| InChI | InChI=1S/C26H38N4O4/c1-5-8-21-23(14-13-20(24(21)32)22(31)17-26(2,3)4)34-16-7-6-15-33-19-11-9-18(10-12-19)25(27)29-30-28/h9-14,30,32H,5-8,15-17,28H2,1-4H3,(H2,27,29) |
| InChIKey | LFMIFESDOHJRPR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|