C25H33NO7 — CID 168958318
3-[2-[2-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]ethylamino]ethoxy]-4-methoxybenzoic acid (PubChem CID 168958318) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is 3-[2-[2-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]ethylamino]ethoxy]-4-methoxybenzoic acid.
| Compound Name | 3-[2-[2-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]ethylamino]ethoxy]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 168958318 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 3-[2-[2-[4-(3,3-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]ethylamino]ethoxy]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCCNCCOc1ccc(C(=O)CC(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C25H33NO7/c1-16-20(9-7-18(23(16)28)19(27)15-25(2,3)4)32-12-10-26-11-13-33-22-14-17(24(29)30)6-8-21(22)31-5/h6-9,14,26,28H,10-13,15H2,1-5H3,(H,29,30) |
| InChIKey | ZITSQDXDZOPYEN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|