C26H35NO6 — CID 118437072
3-[4-[4-(2,2-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxy-N-methylbenzamide (PubChem CID 118437072) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-[4-[4-(2,2-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxy-N-methylbenzamide.
| Compound Name | 3-[4-[4-(2,2-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 118437072 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 3-[4-[4-(2,2-dimethylbutanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxy-N-methylbenzamide |
| SMILES | CCC(C)(C)C(=O)c1ccc(OCCCCOc2cc(C(=O)NC)ccc2OC)c(C)c1O |
| InChI | InChI=1S/C26H35NO6/c1-7-26(3,4)24(29)19-11-13-20(17(2)23(19)28)32-14-8-9-15-33-22-16-18(25(30)27-5)10-12-21(22)31-6/h10-13,16,28H,7-9,14-15H2,1-6H3,(H,27,30) |
| InChIKey | BREUFVYVAXNDAL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|