C26H28O6 — CID 176768272
[2-hydroxy-4-[4-(2-methoxyphenoxy)butoxy]-3-methylphenyl]-(3-methoxyphenyl)methanone (PubChem CID 176768272) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is [2-hydroxy-4-[4-(2-methoxyphenoxy)butoxy]-3-methylphenyl]-(3-methoxyphenyl)methanone.
| Compound Name | [2-hydroxy-4-[4-(2-methoxyphenoxy)butoxy]-3-methylphenyl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 176768272 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [2-hydroxy-4-[4-(2-methoxyphenoxy)butoxy]-3-methylphenyl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2ccc(OCCCCOc3ccccc3OC)c(C)c2O)c1 |
| InChI | InChI=1S/C26H28O6/c1-18-22(31-15-6-7-16-32-24-12-5-4-11-23(24)30-3)14-13-21(25(18)27)26(28)19-9-8-10-20(17-19)29-2/h4-5,8-14,17,27H,6-7,15-16H2,1-3H3 |
| InChIKey | BHYBVNWFCKIRRW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|