C32H29ClN4O5 — CID 87963419
benzoyl chloride;[2-hydroxy-3-methyl-4-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-phenylmethanone (PubChem CID 87963419) has the molecular formula C32H29ClN4O5 and a molecular weight of 585.06 g/mol. Its IUPAC name is benzoyl chloride;[2-hydroxy-3-methyl-4-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-phenylmethanone.
| Compound Name | benzoyl chloride;[2-hydroxy-3-methyl-4-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 87963419 |
| Molecular Formula | C32H29ClN4O5 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | benzoyl chloride;[2-hydroxy-3-methyl-4-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-phenylmethanone |
| SMILES | Cc1c(OCCCCOc2ccc(-c3nn[nH]n3)cc2)ccc(C(=O)c2ccccc2)c1O.O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C25H24N4O4.C7H5ClO/c1-17-22(14-13-21(23(17)30)24(31)18-7-3-2-4-8-18)33-16-6-5-15-32-20-11-9-19(10-12-20)25-26-28-29-27-25;8-7(9)6-4-2-1-3-5-6/h2-4,7-14,30H,5-6,15-16H2,1H3,(H,26,27,28,29);1-5H |
| InChIKey | HTYXUYYWKHMSNN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|