C22H28O4 — CID 11494153
1-[2-hydroxy-3-methyl-4-(4-phenoxybutoxy)phenyl]-3-methylbutan-1-one (PubChem CID 11494153) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[2-hydroxy-3-methyl-4-(4-phenoxybutoxy)phenyl]-3-methylbutan-1-one.
| Compound Name | 1-[2-hydroxy-3-methyl-4-(4-phenoxybutoxy)phenyl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 11494153 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[2-hydroxy-3-methyl-4-(4-phenoxybutoxy)phenyl]-3-methylbutan-1-one |
| SMILES | Cc1c(OCCCCOc2ccccc2)ccc(C(=O)CC(C)C)c1O |
| InChI | InChI=1S/C22H28O4/c1-16(2)15-20(23)19-11-12-21(17(3)22(19)24)26-14-8-7-13-25-18-9-5-4-6-10-18/h4-6,9-12,16,24H,7-8,13-15H2,1-3H3 |
| InChIKey | XTUHVYJHTALVBU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|