C24H27F3N2O3 — CID 11496073
1-[2-hydroxy-3-methyl-4-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butoxy]phenyl]-3-methylbutan-1-one (PubChem CID 11496073) has the molecular formula C24H27F3N2O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-[2-hydroxy-3-methyl-4-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butoxy]phenyl]-3-methylbutan-1-one.
| Compound Name | 1-[2-hydroxy-3-methyl-4-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butoxy]phenyl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 11496073 |
| Molecular Formula | C24H27F3N2O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[2-hydroxy-3-methyl-4-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butoxy]phenyl]-3-methylbutan-1-one |
| SMILES | Cc1c(OCCCCn2c(C(F)(F)F)nc3ccccc32)ccc(C(=O)CC(C)C)c1O |
| InChI | InChI=1S/C24H27F3N2O3/c1-15(2)14-20(30)17-10-11-21(16(3)22(17)31)32-13-7-6-12-29-19-9-5-4-8-18(19)28-23(29)24(25,26)27/h4-5,8-11,15,31H,6-7,12-14H2,1-3H3 |
| InChIKey | YVQSVUVAOQSJQN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|