C21H23F3N2O — CID 16996825
1-[4-(2-propan-2-ylphenoxy)butyl]-2-(trifluoromethyl)benzimidazole (PubChem CID 16996825) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[4-(2-propan-2-ylphenoxy)butyl]-2-(trifluoromethyl)benzimidazole.
| Compound Name | 1-[4-(2-propan-2-ylphenoxy)butyl]-2-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 16996825 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[4-(2-propan-2-ylphenoxy)butyl]-2-(trifluoromethyl)benzimidazole |
| SMILES | CC(C)c1ccccc1OCCCCn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C21H23F3N2O/c1-15(2)16-9-3-6-12-19(16)27-14-8-7-13-26-18-11-5-4-10-17(18)25-20(26)21(22,23)24/h3-6,9-12,15H,7-8,13-14H2,1-2H3 |
| InChIKey | GYNMOZQVXWJTMZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|