C29H34N2O4 — CID 17001614
1-[4-(2-propan-2-ylphenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole (PubChem CID 17001614) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 1-[4-(2-propan-2-ylphenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole.
| Compound Name | 1-[4-(2-propan-2-ylphenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 17001614 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 1-[4-(2-propan-2-ylphenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
| SMILES | COc1cc(-c2nc3ccccc3n2CCCCOc2ccccc2C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N2O4/c1-20(2)22-12-6-9-15-25(22)35-17-11-10-16-31-24-14-8-7-13-23(24)30-29(31)21-18-26(32-3)28(34-5)27(19-21)33-4/h6-9,12-15,18-20H,10-11,16-17H2,1-5H3 |
| InChIKey | YKAGSQGECKEUGR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|