C26H27ClN2O4 — CID 17001619
1-[4-(2-chlorophenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole (PubChem CID 17001619) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is 1-[4-(2-chlorophenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole.
| Compound Name | 1-[4-(2-chlorophenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 17001619 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 1-[4-(2-chlorophenoxy)butyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
| SMILES | COc1cc(-c2nc3ccccc3n2CCCCOc2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C26H27ClN2O4/c1-30-23-16-18(17-24(31-2)25(23)32-3)26-28-20-11-5-6-12-21(20)29(26)14-8-9-15-33-22-13-7-4-10-19(22)27/h4-7,10-13,16-17H,8-9,14-15H2,1-3H3 |
| InChIKey | OAKUUDSYNJCBHA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|