C25H25ClN2O3 — CID 17001450
1-[3-(4-chloro-3-methylphenoxy)propyl]-2-(3,4-dimethoxyphenyl)benzimidazole (PubChem CID 17001450) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is 1-[3-(4-chloro-3-methylphenoxy)propyl]-2-(3,4-dimethoxyphenyl)benzimidazole.
| Compound Name | 1-[3-(4-chloro-3-methylphenoxy)propyl]-2-(3,4-dimethoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 17001450 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[3-(4-chloro-3-methylphenoxy)propyl]-2-(3,4-dimethoxyphenyl)benzimidazole |
| SMILES | COc1ccc(-c2nc3ccccc3n2CCCOc2ccc(Cl)c(C)c2)cc1OC |
| InChI | InChI=1S/C25H25ClN2O3/c1-17-15-19(10-11-20(17)26)31-14-6-13-28-22-8-5-4-7-21(22)27-25(28)18-9-12-23(29-2)24(16-18)30-3/h4-5,7-12,15-16H,6,13-14H2,1-3H3 |
| InChIKey | XKKGJIYQHIOORR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|