C13H16BF3N2O — CID 70965481
methyl-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butyl]borinic acid (PubChem CID 70965481) has the molecular formula C13H16BF3N2O and a molecular weight of 284.09 g/mol. Its IUPAC name is methyl-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butyl]borinic acid.
| Compound Name | methyl-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butyl]borinic acid |
|---|---|
| PubChem CID | 70965481 |
| Molecular Formula | C13H16BF3N2O |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | methyl-[4-[2-(trifluoromethyl)benzimidazol-1-yl]butyl]borinic acid |
| SMILES | CB(O)CCCCn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C13H16BF3N2O/c1-14(20)8-4-5-9-19-11-7-3-2-6-10(11)18-12(19)13(15,16)17/h2-3,6-7,20H,4-5,8-9H2,1H3 |
| InChIKey | AQBXINYXRHFHHQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|