C29H32N2O3 — CID 91070713
1-[2-hydroxy-3-methyl-4-[4-(2-phenylbenzimidazol-1-yl)butoxy]phenyl]-3-methylbutan-2-one (PubChem CID 91070713) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-[2-hydroxy-3-methyl-4-[4-(2-phenylbenzimidazol-1-yl)butoxy]phenyl]-3-methylbutan-2-one.
| Compound Name | 1-[2-hydroxy-3-methyl-4-[4-(2-phenylbenzimidazol-1-yl)butoxy]phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 91070713 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-[2-hydroxy-3-methyl-4-[4-(2-phenylbenzimidazol-1-yl)butoxy]phenyl]-3-methylbutan-2-one |
| SMILES | Cc1c(OCCCCn2c(-c3ccccc3)nc3ccccc32)ccc(CC(=O)C(C)C)c1O |
| InChI | InChI=1S/C29H32N2O3/c1-20(2)26(32)19-23-15-16-27(21(3)28(23)33)34-18-10-9-17-31-25-14-8-7-13-24(25)30-29(31)22-11-5-4-6-12-22/h4-8,11-16,20,33H,9-10,17-19H2,1-3H3 |
| InChIKey | QWURCUNGEILQHJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|