C29H31ClN2O4 — CID 69249903
1-[4-[4-[2-(3-chlorophenyl)benzimidazol-1-yl]oxybutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-1-one (PubChem CID 69249903) has the molecular formula C29H31ClN2O4 and a molecular weight of 507.03 g/mol. Its IUPAC name is 1-[4-[4-[2-(3-chlorophenyl)benzimidazol-1-yl]oxybutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[4-[2-(3-chlorophenyl)benzimidazol-1-yl]oxybutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 69249903 |
| Molecular Formula | C29H31ClN2O4 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-[4-[4-[2-(3-chlorophenyl)benzimidazol-1-yl]oxybutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-1-one |
| SMILES | Cc1c(OCCCCOn2c(-c3cccc(Cl)c3)nc3ccccc32)ccc(C(=O)CC(C)C)c1O |
| InChI | InChI=1S/C29H31ClN2O4/c1-19(2)17-26(33)23-13-14-27(20(3)28(23)34)35-15-6-7-16-36-32-25-12-5-4-11-24(25)31-29(32)21-9-8-10-22(30)18-21/h4-5,8-14,18-19,34H,6-7,15-17H2,1-3H3 |
| InChIKey | HAOPUBCQZWVOMA-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|