C26H26O5 — CID 126551922
[3-[3-[[3-hydroxy-2-methyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate (PubChem CID 126551922) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is [3-[3-[[3-hydroxy-2-methyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate.
| Compound Name | [3-[3-[[3-hydroxy-2-methyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate |
|---|---|
| PubChem CID | 126551922 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [3-[3-[[3-hydroxy-2-methyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate |
| SMILES | Cc1c(OCc2cccc(-c3cccc(OC=O)c3)c2)ccc(C(=O)CC(C)C)c1O |
| InChI | InChI=1S/C26H26O5/c1-17(2)12-24(28)23-10-11-25(18(3)26(23)29)30-15-19-6-4-7-20(13-19)21-8-5-9-22(14-21)31-16-27/h4-11,13-14,16-17,29H,12,15H2,1-3H3 |
| InChIKey | IKYZQKGPVQHLFT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|