C27H27ClO4 — CID 126551927
[2-chloro-5-[3-[[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate (PubChem CID 126551927) has the molecular formula C27H27ClO4 and a molecular weight of 450.96 g/mol. Its IUPAC name is [2-chloro-5-[3-[[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate.
| Compound Name | [2-chloro-5-[3-[[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate |
|---|---|
| PubChem CID | 126551927 |
| Molecular Formula | C27H27ClO4 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [2-chloro-5-[3-[[2,3-dimethyl-4-(3-methylbutanoyl)phenoxy]methyl]phenyl]phenyl] formate |
| SMILES | Cc1c(OCc2cccc(-c3ccc(Cl)c(OC=O)c3)c2)ccc(C(=O)CC(C)C)c1C |
| InChI | InChI=1S/C27H27ClO4/c1-17(2)12-25(30)23-9-11-26(19(4)18(23)3)31-15-20-6-5-7-21(13-20)22-8-10-24(28)27(14-22)32-16-29/h5-11,13-14,16-17H,12,15H2,1-4H3 |
| InChIKey | GRVMBHZMMJDFQO-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|