C28H28O5 — CID 126551914
[3-[3-[[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]phenyl] formate (PubChem CID 126551914) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is [3-[3-[[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]phenyl] formate.
| Compound Name | [3-[3-[[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]phenyl] formate |
|---|---|
| PubChem CID | 126551914 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [3-[3-[[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]phenyl] formate |
| SMILES | Cc1c(OCc2cccc(-c3cccc(OC=O)c3)c2)ccc(C(=O)CC2CCCC2)c1O |
| InChI | InChI=1S/C28H28O5/c1-19-27(13-12-25(28(19)31)26(30)15-20-6-2-3-7-20)32-17-21-8-4-9-22(14-21)23-10-5-11-24(16-23)33-18-29/h4-5,8-14,16,18,20,31H,2-3,6-7,15,17H2,1H3 |
| InChIKey | ILBMDALLNDBBOQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|