C22H26O7 — CID 126551960
[4-[4-(3-hydroxy-2-methyl-4-propanoylphenoxy)butoxy]-3-methoxyphenyl] formate (PubChem CID 126551960) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [4-[4-(3-hydroxy-2-methyl-4-propanoylphenoxy)butoxy]-3-methoxyphenyl] formate.
| Compound Name | [4-[4-(3-hydroxy-2-methyl-4-propanoylphenoxy)butoxy]-3-methoxyphenyl] formate |
|---|---|
| PubChem CID | 126551960 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [4-[4-(3-hydroxy-2-methyl-4-propanoylphenoxy)butoxy]-3-methoxyphenyl] formate |
| SMILES | CCC(=O)c1ccc(OCCCCOc2ccc(OC=O)cc2OC)c(C)c1O |
| InChI | InChI=1S/C22H26O7/c1-4-18(24)17-8-10-19(15(2)22(17)25)27-11-5-6-12-28-20-9-7-16(29-14-23)13-21(20)26-3/h7-10,13-14,25H,4-6,11-12H2,1-3H3 |
| InChIKey | PJSCDOHEAUTONH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|