C23H26O7 — CID 168958353
4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzoic acid (PubChem CID 168958353) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 168958353 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzoic acid |
| SMILES | CCCC(=O)c1ccc(OC/C=C/COc2ccc(C(=O)O)cc2OC)c(C)c1O |
| InChI | InChI=1S/C23H26O7/c1-4-7-18(24)17-9-11-19(15(2)22(17)25)29-12-5-6-13-30-20-10-8-16(23(26)27)14-21(20)28-3/h5-6,8-11,14,25H,4,7,12-13H2,1-3H3,(H,26,27)/b6-5+ |
| InChIKey | LKGCFKAUHRSNFE-AATRIKPKSA-N |
| XLogP | 4.40 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|