C22H27NO6 — CID 168958338
3-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethoxy]ethylamino]benzoic acid (PubChem CID 168958338) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethoxy]ethylamino]benzoic acid.
| Compound Name | 3-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethoxy]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 168958338 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-[2-[2-(4-butanoyl-3-hydroxy-2-methylphenoxy)ethoxy]ethylamino]benzoic acid |
| SMILES | CCCC(=O)c1ccc(OCCOCCNc2cccc(C(=O)O)c2)c(C)c1O |
| InChI | InChI=1S/C22H27NO6/c1-3-5-19(24)18-8-9-20(15(2)21(18)25)29-13-12-28-11-10-23-17-7-4-6-16(14-17)22(26)27/h4,6-9,14,23,25H,3,5,10-13H2,1-2H3,(H,26,27) |
| InChIKey | PGIFWJSTIROASI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|