C25H31FO7 — CID 118447135
3-[4-[4-(4-fluoro-4-methylpentanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxybenzoic acid (PubChem CID 118447135) has the molecular formula C25H31FO7 and a molecular weight of 462.51 g/mol. Its IUPAC name is 3-[4-[4-(4-fluoro-4-methylpentanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxybenzoic acid.
| Compound Name | 3-[4-[4-(4-fluoro-4-methylpentanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 118447135 |
| Molecular Formula | C25H31FO7 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 3-[4-[4-(4-fluoro-4-methylpentanoyl)-3-hydroxy-2-methylphenoxy]butoxy]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCCCCOc1ccc(C(=O)CCC(C)(C)F)c(O)c1C |
| InChI | InChI=1S/C25H31FO7/c1-16-20(10-8-18(23(16)28)19(27)11-12-25(2,3)26)32-13-5-6-14-33-22-15-17(24(29)30)7-9-21(22)31-4/h7-10,15,28H,5-6,11-14H2,1-4H3,(H,29,30) |
| InChIKey | WAUMOWLEECOPDT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|