C30H42N2O6S — CID 144944424
1-[2-hydroxy-4-[4-[2-methoxy-5-(4-methylsulfanylpiperazine-1-carbonyl)phenoxy]butoxy]-3-methylphenyl]-3,3-dimethylbutan-1-one (PubChem CID 144944424) has the molecular formula C30H42N2O6S and a molecular weight of 558.74 g/mol. Its IUPAC name is 1-[2-hydroxy-4-[4-[2-methoxy-5-(4-methylsulfanylpiperazine-1-carbonyl)phenoxy]butoxy]-3-methylphenyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[2-hydroxy-4-[4-[2-methoxy-5-(4-methylsulfanylpiperazine-1-carbonyl)phenoxy]butoxy]-3-methylphenyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 144944424 |
| Molecular Formula | C30H42N2O6S |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 1-[2-hydroxy-4-[4-[2-methoxy-5-(4-methylsulfanylpiperazine-1-carbonyl)phenoxy]butoxy]-3-methylphenyl]-3,3-dimethylbutan-1-one |
| SMILES | COc1ccc(C(=O)N2CCN(SC)CC2)cc1OCCCCOc1ccc(C(=O)CC(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C30H42N2O6S/c1-21-25(12-10-23(28(21)34)24(33)20-30(2,3)4)37-17-7-8-18-38-27-19-22(9-11-26(27)36-5)29(35)31-13-15-32(39-6)16-14-31/h9-12,19,34H,7-8,13-18,20H2,1-6H3 |
| InChIKey | DELPRYDWPCJVLZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|