C23H26O6 — CID 168958504
4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzaldehyde (PubChem CID 168958504) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 168958504 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4-[(E)-4-(4-butanoyl-3-hydroxy-2-methylphenoxy)but-2-enoxy]-3-methoxybenzaldehyde |
| SMILES | CCCC(=O)c1ccc(OC/C=C/COc2ccc(C=O)cc2OC)c(C)c1O |
| InChI | InChI=1S/C23H26O6/c1-4-7-19(25)18-9-11-20(16(2)23(18)26)28-12-5-6-13-29-21-10-8-17(15-24)14-22(21)27-3/h5-6,8-11,14-15,26H,4,7,12-13H2,1-3H3/b6-5+ |
| InChIKey | VPKDPQMCQBBQPV-AATRIKPKSA-N |
| XLogP | 4.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|