About deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol
deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol (PubChem CID 157082328) has the molecular formula C16H18O5
and a molecular weight of 291.32 g/mol. Its IUPAC name is deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol.
Molecular Properties
| Compound Name | deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol |
| PubChem CID | 157082328 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol |
| SMILES | COc1cc(C=O)ccc1OCC=O.Oc1ccccc1.[H][2H] |
| InChI | InChI=1S/C10H10O4.C6H6O.H2/c1-13-10-6-8(7-12)2-3-9(10)14-5-4-11;7-6-4-2-1-3-5-6;/h2-4,6-7H,5H2,1H3;1-5,7H;1H/i;;1+1 |
| InChIKey | ADRRMQTXGCUFCV-FCHARDOESA-N |
| XLogP | 2.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol?
The IUPAC name of deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol (CID 157082328) is deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol.
What is the SMILES notation for deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol?
The canonical SMILES for deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol is COc1cc(C=O)ccc1OCC=O.Oc1ccccc1.[H][2H].
What is the InChIKey of deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol?
The InChIKey is ADRRMQTXGCUFCV-FCHARDOESA-N. The full InChI is InChI=1S/C10H10O4.C6H6O.H2/c1-13-10-6-8(7-12)2-3-9(10)14-5-4-11;7-6-4-2-1-3-5-6;/h2-4,6-7H,5H2,1H3;1-5,7H;1H/i;;1+1.
What are the key properties of deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol?
deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol has a molecular weight of 291.32 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;3-methoxy-4-(2-oxoethoxy)benzaldehyde;phenol is sourced from PubChem (CID 157082328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).