C18H17O6- — CID 2292072
2-[3-(4-formyl-2-methoxyphenoxy)propoxy]benzoate (PubChem CID 2292072) has the molecular formula C18H17O6- and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[3-(4-formyl-2-methoxyphenoxy)propoxy]benzoate.
| Compound Name | 2-[3-(4-formyl-2-methoxyphenoxy)propoxy]benzoate |
|---|---|
| PubChem CID | 2292072 |
| Molecular Formula | C18H17O6- |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[3-(4-formyl-2-methoxyphenoxy)propoxy]benzoate |
| SMILES | COc1cc(C=O)ccc1OCCCOc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C18H18O6/c1-22-17-11-13(12-19)7-8-16(17)24-10-4-9-23-15-6-3-2-5-14(15)18(20)21/h2-3,5-8,11-12H,4,9-10H2,1H3,(H,20,21)/p-1 |
| InChIKey | ARMODUMADBVIPT-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|