C25H29FO6 — CID 126551849
[5-[4-[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]butoxy]-2-fluorophenyl] formate (PubChem CID 126551849) has the molecular formula C25H29FO6 and a molecular weight of 444.50 g/mol. Its IUPAC name is [5-[4-[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]butoxy]-2-fluorophenyl] formate.
| Compound Name | [5-[4-[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]butoxy]-2-fluorophenyl] formate |
|---|---|
| PubChem CID | 126551849 |
| Molecular Formula | C25H29FO6 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [5-[4-[4-(2-cyclopentylacetyl)-3-hydroxy-2-methylphenoxy]butoxy]-2-fluorophenyl] formate |
| SMILES | Cc1c(OCCCCOc2ccc(F)c(OC=O)c2)ccc(C(=O)CC2CCCC2)c1O |
| InChI | InChI=1S/C25H29FO6/c1-17-23(11-9-20(25(17)29)22(28)14-18-6-2-3-7-18)31-13-5-4-12-30-19-8-10-21(26)24(15-19)32-16-27/h8-11,15-16,18,29H,2-7,12-14H2,1H3 |
| InChIKey | PLOHYUGPOQWBQO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|